Products 2940962-53-6
CAS 2940962-53-6 is the registry number for 1-(acetoxymethyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(acetyloxymethyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylic acid (CAS 2940962-53-6) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: 1-(acetyloxymethyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylic acid. InChIKey: GKYDJAWNJYRWQO-UHFFFAOYSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 1-(acetyloxymethyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylic acid |
| InChIKey | GKYDJAWNJYRWQO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC12CCC(C1)(CO2)C(=O)O |
Computed by PubChem (NCBI)