CAS 29598-22-9 is the registry number for Gliquidone Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-dimethyl-3H-chromen-2-one (CAS 29598-22-9) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 4,4-dimethyl-3H-chromen-2-one. InChIKey: ZBSFDCKGUFSQLN-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 4,4-dimethyl-3H-chromen-2-one |
| InChIKey | ZBSFDCKGUFSQLN-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)OC2=CC=CC=C21)C |
Computed by PubChem (NCBI)