Products 2969253-37-8
CAS 2969253-37-8 is the registry number for 1-(2,6-Difluoro-4-(methoxymethoxy)phenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[2,6-difluoro-4-(methoxymethoxy)phenyl]-2,2-difluoroethanone (CAS 2969253-37-8) is a chemical compound with the molecular formula C10H8F4O3 and a molecular weight of 252.16 g/mol. IUPAC name: 1-[2,6-difluoro-4-(methoxymethoxy)phenyl]-2,2-difluoroethanone. InChIKey: IPFGYIALVXJDCN-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | 1-[2,6-difluoro-4-(methoxymethoxy)phenyl]-2,2-difluoroethanone |
| InChIKey | IPFGYIALVXJDCN-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C(C(=C1)F)C(=O)C(F)F)F |
Computed by PubChem (NCBI)