Products 2969355-95-9
CAS 2969355-95-9 is the registry number for 6,7-dichloro-3-ethoxyisobenzofuran-1(3H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6,7-dichloro-3-ethoxy-3H-2-benzofuran-1-one (CAS 2969355-95-9) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: 6,7-dichloro-3-ethoxy-3H-2-benzofuran-1-one. InChIKey: FQPVPMJFRKJHRH-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 6,7-dichloro-3-ethoxy-3H-2-benzofuran-1-one |
| InChIKey | FQPVPMJFRKJHRH-UHFFFAOYSA-N |
| SMILES | CCOC1C2=C(C(=C(C=C2)Cl)Cl)C(=O)O1 |
Computed by PubChem (NCBI)