Products 2973762-53-5
CAS 2973762-53-5 is the registry number for 8-Amino-10-methyldibenzo[b,f][1,4]thiazepin-11(10H)-one 5-oxide, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg.
3-amino-5-methyl-11-oxobenzo[b][1,4]benzothiazepin-6-one (CAS 2973762-53-5) is a chemical compound with the molecular formula C14H12N2O2S and a molecular weight of 272.32 g/mol. IUPAC name: 3-amino-5-methyl-11-oxobenzo[b][1,4]benzothiazepin-6-one. InChIKey: HNWKTACBMGJHHG-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 3-amino-5-methyl-11-oxobenzo[b][1,4]benzothiazepin-6-one |
| InChIKey | HNWKTACBMGJHHG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)N)S(=O)C3=CC=CC=C3C1=O |
Computed by PubChem (NCBI)