Products 300674-03-7

CAS 300674-03-7 is the registry number for 5-Methoxy-2-phenylbenzofuran-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

5-methoxy-2-phenyl-1-benzofuran-3-carboxylic acid (CAS 300674-03-7) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 5-methoxy-2-phenyl-1-benzofuran-3-carboxylic acid. InChIKey: ZAWWFXRAMMHWMM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12O4
Molecular weight268.26 g/mol
IUPAC name5-methoxy-2-phenyl-1-benzofuran-3-carboxylic acid
InChIKeyZAWWFXRAMMHWMM-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)OC(=C2C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)