CAS 30087-33-3 appears in our catalog under these names: 2-(9-Oxoxanthen-2-yl)propionic acid, 95%, 2–(9–Oxoxanthen–2–yl)propionic Acid, 2-(9-Oxoxanthen-2-yl)propionic acid, 2-(9-Oxoxanthen-2-yl)propionic Acid, >98.0%(GC)(T), 2-(9-Oxo-9H-xanthen-2-yl)propanoic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 250mg, 2g, 5g, 100mg.
2-(9-oxoxanthen-2-yl)propanoic acid (CAS 30087-33-3) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 2-(9-oxoxanthen-2-yl)propanoic acid. InChIKey: JUCCZCZDAPBGIV-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 2-(9-oxoxanthen-2-yl)propanoic acid |
| InChIKey | JUCCZCZDAPBGIV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O |
Computed by PubChem (NCBI)