CAS 301653-18-9 is the registry number for 2-Chloro-4-fluorophenyl acetate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-chloro-4-fluorophenyl) acetate (CAS 301653-18-9) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: (2-chloro-4-fluorophenyl) acetate. InChIKey: CTWQBKXPINCJIX-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | (2-chloro-4-fluorophenyl) acetate |
| InChIKey | CTWQBKXPINCJIX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)F)Cl |
Computed by PubChem (NCBI)