Products 3026089-41-5
CAS 3026089-41-5 is the registry number for tert-butyl (S,E)-(1-cyclopropyl-3-(methylsulfonyl)allyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Tert-butyl N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]carbamate (CAS 3026089-41-5) is a chemical compound with the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. IUPAC name: tert-butyl N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]carbamate. InChIKey: WLAFKRGNVHRRIA-QROSGCPLSA-N.
| Molecular formula | C12H21NO4S |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | tert-butyl N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]carbamate |
| InChIKey | WLAFKRGNVHRRIA-QROSGCPLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/S(=O)(=O)C)C1CC1 |
Computed by PubChem (NCBI)