Products 3026594-96-4
CAS 3026594-96-4 appears in our catalog under these names: (S)-2-Methoxy-1-(3-methoxyphenyl)ethan-1-amine (hydrochloride), 95%, 95%, (S)-2-Methoxy-1-(3-methoxyphenyl)ethan-1-amine (hydrochloride), 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1S)-2-methoxy-1-(3-methoxyphenyl)ethanamine;hydrochloride (CAS 3026594-96-4) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1S)-2-methoxy-1-(3-methoxyphenyl)ethanamine;hydrochloride. InChIKey: SRIRQTBMUVSCMN-HNCPQSOCSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1S)-2-methoxy-1-(3-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | SRIRQTBMUVSCMN-HNCPQSOCSA-N |
| SMILES | COC[C@H](C1=CC(=CC=C1)OC)N.Cl |
Computed by PubChem (NCBI)