Products 3026728-21-9
CAS 3026728-21-9 is the registry number for methyl 7-hydroxy-6-nitro-2,3-dihydrobenzofuran-5-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 7-hydroxy-6-nitro-2,3-dihydro-1-benzofuran-5-carboxylate (CAS 3026728-21-9) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: methyl 7-hydroxy-6-nitro-2,3-dihydro-1-benzofuran-5-carboxylate. InChIKey: LWWVPQPYEIEAOZ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | methyl 7-hydroxy-6-nitro-2,3-dihydro-1-benzofuran-5-carboxylate |
| InChIKey | LWWVPQPYEIEAOZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C2C(=C1)CCO2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)