CAS 302841-89-0 appears in our catalog under these names: Ro 67-4853, 98+%, Ro 67-4853, Ro 67–4853, Ro 67-4853 98+%, Ro 67-4853, 99.90%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: on request, 10mg, 25mg, 5mg, 1mg, 50mg, 100mg, 250mg.
Butyl N-(9H-xanthene-9-carbonyl)carbamate (CAS 302841-89-0) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: butyl N-(9H-xanthene-9-carbonyl)carbamate. InChIKey: RQBUXEUMZZQUFY-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | butyl N-(9H-xanthene-9-carbonyl)carbamate |
| InChIKey | RQBUXEUMZZQUFY-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)NC(=O)C1C2=CC=CC=C2OC3=CC=CC=C13 |
Computed by PubChem (NCBI)