CAS 302964-02-9 appears in our catalog under these names: 2–(tert–Butoxycarbonylamino)thiazole–5–carboxylic Acid, 2-(tert-Butoxycarbonylamino)thiazole-5-carboxylic Acid, >98.0%(HPLC)(T), 2-(tert-butoxycarbonylamino)thiazole-5-carboxylic acid, 97%, 97%, 2-N-Boc-Amino-thiazole-5-carboxylic acid, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 200mg, 1g, 250mg, 10g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid (CAS 302964-02-9) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid. InChIKey: QNFLEDLPOVONCN-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid |
| InChIKey | QNFLEDLPOVONCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(S1)C(=O)O |
Computed by PubChem (NCBI)