CAS 30318-36-6 is the registry number for N,N-Dimethyl Benzilamide. Offered by: TRC. Available pack sizes: 250mg.
2-hydroxy-N,N-dimethyl-2,2-diphenylacetamide (CAS 30318-36-6) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: 2-hydroxy-N,N-dimethyl-2,2-diphenylacetamide. InChIKey: CHJDULVEUDZVFV-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-hydroxy-N,N-dimethyl-2,2-diphenylacetamide |
| InChIKey | CHJDULVEUDZVFV-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)