Products 3032608-35-5
CAS 3032608-35-5 is the registry number for Antibacterial agent 82. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methoxy-4-[5-(4-phenylphenyl)-1H-pyrazol-3-yl]phenol (CAS 3032608-35-5) is a chemical compound with the molecular formula C22H18N2O2 and a molecular weight of 342.4 g/mol. IUPAC name: 2-methoxy-4-[5-(4-phenylphenyl)-1H-pyrazol-3-yl]phenol. InChIKey: YEOZDARBGCURFA-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 2-methoxy-4-[5-(4-phenylphenyl)-1H-pyrazol-3-yl]phenol |
| InChIKey | YEOZDARBGCURFA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NNC(=C2)C3=CC=C(C=C3)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 82