Products 3037676-54-0
CAS 3037676-54-0 is the registry number for 4-(2-(Methylsulfonyl)propan-2-yl)aniline hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-methylsulfonylpropan-2-yl)aniline;hydrochloride (CAS 3037676-54-0) is a chemical compound with the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. IUPAC name: 4-(2-methylsulfonylpropan-2-yl)aniline;hydrochloride. InChIKey: QTGUEMJNGGIYMT-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2S |
|---|---|
| Molecular weight | 249.76 g/mol |
| IUPAC name | 4-(2-methylsulfonylpropan-2-yl)aniline;hydrochloride |
| InChIKey | QTGUEMJNGGIYMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)N)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)