CAS 889856-99-9 is the registry number for 1-(4-(Methylsulfonyl)phenyl)propan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride (CAS 889856-99-9) is a chemical compound with the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. IUPAC name: 1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride. InChIKey: QQFMYVCGLZUZMC-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2S |
|---|---|
| Molecular weight | 249.76 g/mol |
| IUPAC name | 1-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride |
| InChIKey | QQFMYVCGLZUZMC-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)