CAS 860701-53-7 appears in our catalog under these names: (4-(Isopropylsulfonyl)phenyl)methanamine hydrochloride, 98%, (4-(Isopropylsulfonyl)phenyl)methanamine hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg, 2.5g.
(4-propan-2-ylsulfonylphenyl)methanamine;hydrochloride (CAS 860701-53-7) is a chemical compound with the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. IUPAC name: (4-propan-2-ylsulfonylphenyl)methanamine;hydrochloride. InChIKey: MZHLIIROGPOGOA-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2S |
|---|---|
| Molecular weight | 249.76 g/mol |
| IUPAC name | (4-propan-2-ylsulfonylphenyl)methanamine;hydrochloride |
| InChIKey | MZHLIIROGPOGOA-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)