CAS 1803600-67-0 appears in our catalog under these names: (2-(2-Aminoethanesulfonyl)ethyl)benzene hydrochloride, 95%, (2-(2-Aminoethanesulfonyl)ethyl)benzene hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2-phenylethylsulfonyl)ethanamine;hydrochloride (CAS 1803600-67-0) is a chemical compound with the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. IUPAC name: 2-(2-phenylethylsulfonyl)ethanamine;hydrochloride. InChIKey: OSPCDBOEBRTGNO-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2S |
|---|---|
| Molecular weight | 249.76 g/mol |
| IUPAC name | 2-(2-phenylethylsulfonyl)ethanamine;hydrochloride |
| InChIKey | OSPCDBOEBRTGNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCS(=O)(=O)CCN.Cl |
Computed by PubChem (NCBI)