Products 1431964-13-4

CAS 1431964-13-4 is the registry number for 5-((Diethylamino)methyl)thiophene-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

5-(diethylaminomethyl)thiophene-2-carboxylic acid;hydrochloride (CAS 1431964-13-4) is a chemical compound with the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. IUPAC name: 5-(diethylaminomethyl)thiophene-2-carboxylic acid;hydrochloride. InChIKey: CCDYRQGIXKOXAG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16ClNO2S
Molecular weight249.76 g/mol
IUPAC name5-(diethylaminomethyl)thiophene-2-carboxylic acid;hydrochloride
InChIKeyCCDYRQGIXKOXAG-UHFFFAOYSA-N
SMILESCCN(CC)CC1=CC=C(S1)C(=O)O.Cl

Computed by PubChem (NCBI)