Products 1423032-68-1
CAS 1423032-68-1 appears in our catalog under these names: 2-(4-Methanesulfonylphenyl)propan-1-amine hydrochloride, 2-(4-Methanesulfonylphenyl)propan-1-amine hydrochloride, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 1g.
2-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride (CAS 1423032-68-1) is a chemical compound with the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. IUPAC name: 2-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride. InChIKey: AHMPROPZDVXSNB-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2S |
|---|---|
| Molecular weight | 249.76 g/mol |
| IUPAC name | 2-(4-methylsulfonylphenyl)propan-1-amine;hydrochloride |
| InChIKey | AHMPROPZDVXSNB-UHFFFAOYSA-N |
| SMILES | CC(CN)C1=CC=C(C=C1)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)