CAS 1172352-46-3 appears in our catalog under these names: Methyl-[2-(4-methylphenylsulfonyl)ethyl]amine hydrochloride, 95%, N-Methyl-2-tosylethanamine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
N-methyl-2-(4-methylphenyl)sulfonylethanamine;hydrochloride (CAS 1172352-46-3) is a chemical compound with the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. IUPAC name: N-methyl-2-(4-methylphenyl)sulfonylethanamine;hydrochloride. InChIKey: JKFNQSAKSVPDHT-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2S |
|---|---|
| Molecular weight | 249.76 g/mol |
| IUPAC name | N-methyl-2-(4-methylphenyl)sulfonylethanamine;hydrochloride |
| InChIKey | JKFNQSAKSVPDHT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CCNC.Cl |
Computed by PubChem (NCBI)