CAS 305806-42-2 appears in our catalog under these names: Methyl 4-(thiazol-2-yl)-benzoate, 98%, Methyl 4-(thiazol-2-yl)benzoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
Methyl 4-(1,3-thiazol-2-yl)benzoate (CAS 305806-42-2) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: methyl 4-(1,3-thiazol-2-yl)benzoate. InChIKey: AUKYMEYSRKQKSE-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | methyl 4-(1,3-thiazol-2-yl)benzoate |
| InChIKey | AUKYMEYSRKQKSE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NC=CS2 |
Computed by PubChem (NCBI)