Products 3060-41-1
CAS 3060-41-1 appears in our catalog under these names: 4-Amino-3-Phenylbutanoic Acid Hydrochloride, 98%, 98%, 4-Amino-3-phenyl-butyric acid HCl, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
4-amino-3-phenylbutanoic acid;hydrochloride (CAS 3060-41-1) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 4-amino-3-phenylbutanoic acid;hydrochloride. InChIKey: XSYRYMGYPBGOPS-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 4-amino-3-phenylbutanoic acid;hydrochloride |
| InChIKey | XSYRYMGYPBGOPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Amino-3-phenylbutyric acid hydrochloride, beta-Phenyl-GABA hydrochloride, HYDROCINNAMIC ACID, beta-(AMINOMETHYL)-, HYDROCHLORIDE, gamma-Amino-beta-phenylbutyric acid hydrochloride, Benzenepropanoic acid, beta-(aminomethyl)-, hydrochloride, 4-Amino-3-phenylbutanoic acid hydrochloride, 4-Amino-3-phenylbutyric acid HCl, phenibut hydrochloride, 3-Amino-4-phenylbutyric acid hydrochloride, 4-amino-3-phenylbutanoic acid;hydrochloride