Products 3065496-78-5
CAS 3065496-78-5 appears in our catalog under these names: CRBN ligand-45, 3-(5-Bromo-2-fluorophenyl)piperidine-2,6-dione, >95%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 50mg, 100mg, 250mg, 1g.
3-(5-bromo-2-fluorophenyl)piperidine-2,6-dione (CAS 3065496-78-5) is a chemical compound with the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. IUPAC name: 3-(5-bromo-2-fluorophenyl)piperidine-2,6-dione. InChIKey: LLCMPGDMSWKPRF-UHFFFAOYSA-N.
| Molecular formula | C11H9BrFNO2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 3-(5-bromo-2-fluorophenyl)piperidine-2,6-dione |
| InChIKey | LLCMPGDMSWKPRF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)