Products 30689-96-4
CAS 30689-96-4 is the registry number for 2,3-Dimethyl 6-methylpyrazolo(1,5-a)pyridine-2,3-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Dimethyl 6-methylpyrazolo[1,5-a]pyridine-2,3-dicarboxylate (CAS 30689-96-4) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: dimethyl 6-methylpyrazolo[1,5-a]pyridine-2,3-dicarboxylate. InChIKey: YKIDTQJEOXCDRT-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | dimethyl 6-methylpyrazolo[1,5-a]pyridine-2,3-dicarboxylate |
| InChIKey | YKIDTQJEOXCDRT-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(C(=N2)C(=O)OC)C(=O)OC)C=C1 |
Computed by PubChem (NCBI)