CAS 306935-75-1 is the registry number for 4-(Naphthalen-1-ylamino)-4-oxobut-2-enoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(E)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid (CAS 306935-75-1) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: (E)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid. InChIKey: DNIIAZFRGKFYSJ-CMDGGOBGSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | (E)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid |
| InChIKey | DNIIAZFRGKFYSJ-CMDGGOBGSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)