Products 3070364-24-5
CAS 3070364-24-5 is the registry number for Antifungal agent 127. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-chloro-1-propylindol-2-yl)-1,3,4-oxadiazole (CAS 3070364-24-5) is a chemical compound with the molecular formula C13H12ClN3O and a molecular weight of 261.70 g/mol. IUPAC name: 2-(6-chloro-1-propylindol-2-yl)-1,3,4-oxadiazole. InChIKey: FKGAGIXBKDKQAE-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2-(6-chloro-1-propylindol-2-yl)-1,3,4-oxadiazole |
| InChIKey | FKGAGIXBKDKQAE-UHFFFAOYSA-N |
| SMILES | CCCN1C(=CC2=C1C=C(C=C2)Cl)C3=NN=CO3 |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 127, orb3028569