Products 307989-56-6
CAS 307989-56-6 appears in our catalog under these names: Benzoic acid， 5–aMino–2–(trifluoroMethoxy)–, 5-Amino-2-(trifluoromethoxy)benzoic acid, 5-Amino-2-(trifluoromethoxy)benzoic acid 98%, Benzoic acid, 5-aMino-2-(trifluoroMethoxy)-, 98%, 98%, 5-AMINO-2-(TRIFLUOROMETHOXY)BENZOIC ACID, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 25g.
5-amino-2-(trifluoromethoxy)benzoic acid (CAS 307989-56-6) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 5-amino-2-(trifluoromethoxy)benzoic acid. InChIKey: IVFQGRBOCWDWKI-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 5-amino-2-(trifluoromethoxy)benzoic acid |
| InChIKey | IVFQGRBOCWDWKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)