Products 30837-62-8
CAS 30837-62-8 appears in our catalog under these names: 1H-Perimidine-2-thiol, 1H-PERIMIDINE-2-THIOL, 98%, Perimidine-2(3H)-thione, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 250mg, 1g.
1,3-dihydroperimidine-2-thione (CAS 30837-62-8) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 1,3-dihydroperimidine-2-thione. InChIKey: ZASDGLJUXIVFDL-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 1,3-dihydroperimidine-2-thione |
| InChIKey | ZASDGLJUXIVFDL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)NC(=S)NC3=CC=C2 |
Computed by PubChem (NCBI)