Products 3084715-64-7
CAS 3084715-64-7 is the registry number for tert-Butyl (6S)-7-cyano-6-methyl-8-oxo-5-azaspiro[2.5]octane-5-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (6S)-7-cyano-6-methyl-8-oxo-5-azaspiro[2.5]octane-5-carboxylate (CAS 3084715-64-7) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: tert-butyl (6S)-7-cyano-6-methyl-8-oxo-5-azaspiro[2.5]octane-5-carboxylate. InChIKey: JPEFLOWOTDHFJH-RGURZIINSA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | tert-butyl (6S)-7-cyano-6-methyl-8-oxo-5-azaspiro[2.5]octane-5-carboxylate |
| InChIKey | JPEFLOWOTDHFJH-RGURZIINSA-N |
| SMILES | C[C@H]1C(C(=O)C2(CC2)CN1C(=O)OC(C)(C)C)C#N |
Computed by PubChem (NCBI)