Products 3091872-42-0
CAS 3091872-42-0 is the registry number for Ethyl 2-(1-Tosylhydrazinyl)acetate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-[amino-(4-methylphenyl)sulfonylamino]acetate (CAS 3091872-42-0) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: ethyl 2-[amino-(4-methylphenyl)sulfonylamino]acetate. InChIKey: QWIBHIUJBUHFKM-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | ethyl 2-[amino-(4-methylphenyl)sulfonylamino]acetate |
| InChIKey | QWIBHIUJBUHFKM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(N)S(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 2-(1-Tosylhydrazinyl)acetate