CAS 30923-65-0 appears in our catalog under these names: 1-Cyclopropyl-3-phenylpropane-1,3-dione, 98%, 1-Cyclopropyl-3-phenylpropane-1,3-dione, 1-Cyclopropyl-3-phenylpropane-1,3-dione, 96%, 96%, 3-cyclopropyl-3-hydroxy-1-phenylprop-2-en-1-one, 96%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 2,5g, 250mg, 100mg.
1-cyclopropyl-3-phenylpropane-1,3-dione (CAS 30923-65-0) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 1-cyclopropyl-3-phenylpropane-1,3-dione. InChIKey: ZEPXXRGMHZRBKL-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 1-cyclopropyl-3-phenylpropane-1,3-dione |
| InChIKey | ZEPXXRGMHZRBKL-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)