CAS 309923-18-0 appears in our catalog under these names: 6-(tert-Butylamino)-1,3,5-triazine-2,4(1H,3H)-dione, >95% (HPLC), Terbuthylazine metabolite CGA 324007, Terbuthylazine metabolite CGA 324007 100 µg/mL in Acetonitrile:Methanol, 6-((1,1-Dimethylethyl)amino)-1,3,5-triazine-2,4(1H,3H)-dione,1,3,5-triazine-2,4(1H,3H)-dione, Terbuthylazine Metabolite MT23-GS16984. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 10mg, 50mg, 1ml, 1x10mg.
6-(tert-butylamino)-1H-1,3,5-triazine-2,4-dione (CAS 309923-18-0) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: 6-(tert-butylamino)-1H-1,3,5-triazine-2,4-dione. InChIKey: RMGNIWIYFYKTDC-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 6-(tert-butylamino)-1H-1,3,5-triazine-2,4-dione |
| InChIKey | RMGNIWIYFYKTDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=NC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)