Products 31076-39-8
CAS 31076-39-8 appears in our catalog under these names: Cedeodarin, Cedeodarin, 96.0%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 5 mg, 1 mg.
(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methyl-2,3-dihydrochromen-4-one (CAS 31076-39-8) is a chemical compound with the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. IUPAC name: (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methyl-2,3-dihydrochromen-4-one. InChIKey: KPCWWZLBHGSXPW-JKSUJKDBSA-N.
| Molecular formula | C16H14O7 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methyl-2,3-dihydrochromen-4-one |
| InChIKey | KPCWWZLBHGSXPW-JKSUJKDBSA-N |
| SMILES | CC1=C(C2=C(C=C1O)O[C@@H]([C@H](C2=O)O)C3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)