CAS 31105-90-5 appears in our catalog under these names: 3,4–Difluoro–L–phenylalanine, H-L-Phe(3,4-F2)-OH, (S)-2-Amino-3-(3,4-Difluorophenyl)Propanoic Acid, 95%, 95%, L-3,4-Difluorophenylalanine, 98%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 100mg, 10g.
(2S)-2-amino-3-(3,4-difluorophenyl)propanoic acid (CAS 31105-90-5) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-difluorophenyl)propanoic acid. InChIKey: PRAWYXDDKCVZTL-QMMMGPOBSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-difluorophenyl)propanoic acid |
| InChIKey | PRAWYXDDKCVZTL-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1C[C@@H](C(=O)O)N)F)F |
Computed by PubChem (NCBI)