CAS 31105-92-7 appears in our catalog under these names: (S)–2–Amino–3–(2,5–difluorophenyl)propanoic acid, (S)-2-Amino-3-(2,5-difluorophenyl)propanoic acid, 95%, 95%, 2,5-Difluoro-L-phenylalanine, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2S)-2-amino-3-(2,5-difluorophenyl)propanoic acid (CAS 31105-92-7) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: (2S)-2-amino-3-(2,5-difluorophenyl)propanoic acid. InChIKey: YHYQITHAFYELNW-QMMMGPOBSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,5-difluorophenyl)propanoic acid |
| InChIKey | YHYQITHAFYELNW-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1F)C[C@@H](C(=O)O)N)F |
Computed by PubChem (NCBI)