CAS 31127-40-9 appears in our catalog under these names: 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)methanamine hydrochloride, 95%, 1,4-Benzodioxan-6-methylamine Hydrochloride, 2,3-Dihydro-1,4-benzodioxin-6-ylmethanamine hydrochloride, 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)methanamine, HCl, 97%, 97%, 2,3-Dihydro-1,4-benzodioxin-6-ylmethanamine hydrochloride, 97%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 500mg.
2,3-dihydro-1,4-benzodioxin-6-ylmethanamine;hydrochloride (CAS 31127-40-9) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-6-ylmethanamine;hydrochloride. InChIKey: GVAPQIGVGPWPIN-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-6-ylmethanamine;hydrochloride |
| InChIKey | GVAPQIGVGPWPIN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)