CAS 31127-41-0 is the registry number for 2-((2,3-Dihydro-1,4-benzodioxin-6-ylmethyl)amino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)acetic acid;hydrochloride (CAS 31127-41-0) is a chemical compound with the molecular formula C11H14ClNO4 and a molecular weight of 259.68 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)acetic acid;hydrochloride. InChIKey: LTBWTRRNQJWVAV-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO4 |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)acetic acid;hydrochloride |
| InChIKey | LTBWTRRNQJWVAV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)CNCC(=O)O.Cl |
Computed by PubChem (NCBI)