Products 311761-87-2
CAS 311761-87-2 is the registry number for Tri-p-tolylamine-N15. Offered by: MedChemExpress. Available pack sizes: 1 mg.
4-methyl-N,N-bis(4-methylphenyl)(15N)aniline (CAS 311761-87-2) is a chemical compound with the molecular formula C21H21N and a molecular weight of 288.4 g/mol. IUPAC name: 4-methyl-N,N-bis(4-methylphenyl)(15N)aniline. InChIKey: YXYUIABODWXVIK-ZVDSADNZSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-methyl-N,N-bis(4-methylphenyl)(15N)aniline |
| InChIKey | YXYUIABODWXVIK-ZVDSADNZSA-N |
| SMILES | CC1=CC=C(C=C1)[15N](C2=CC=C(C=C2)C)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)