CAS 31186-13-7 is the registry number for Dehydroaltenusin. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
(4aS)-3,7-dihydroxy-9-methoxy-4a-methylbenzo[c]chromene-2,6-dione (CAS 31186-13-7) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: (4aS)-3,7-dihydroxy-9-methoxy-4a-methylbenzo[c]chromene-2,6-dione. InChIKey: YWYZLBQRCUAQAV-HNNXBMFYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | (4aS)-3,7-dihydroxy-9-methoxy-4a-methylbenzo[c]chromene-2,6-dione |
| InChIKey | YWYZLBQRCUAQAV-HNNXBMFYSA-N |
| SMILES | C[C@]12C=C(C(=O)C=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O |
Computed by PubChem (NCBI)