Products 312274-91-2
CAS 312274-91-2 appears in our catalog under these names: 2-Chloro-5-((4-chlorophenyl)sulfamoyl)benzoic acid, 2-Chloro-5-(4-chloro-phenylsulfamoyl)-benzoic acid, 95%, 2-Chloro-5-((4-chlorophenyl)sulfamoyl)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
2-chloro-5-[(4-chlorophenyl)sulfamoyl]benzoic acid (CAS 312274-91-2) is a chemical compound with the molecular formula C13H9Cl2NO4S and a molecular weight of 346.2 g/mol. IUPAC name: 2-chloro-5-[(4-chlorophenyl)sulfamoyl]benzoic acid. InChIKey: YRPRMTCMCSOUFS-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO4S |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 2-chloro-5-[(4-chlorophenyl)sulfamoyl]benzoic acid |
| InChIKey | YRPRMTCMCSOUFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)