CAS 328106-71-4 appears in our catalog under these names: 4-(3,4-Dichlorobenzenesulfonamido)benzoic acid, 95%, 4-(3,4-Dichloro-benzenesulfonylamino)-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid (CAS 328106-71-4) is a chemical compound with the molecular formula C13H9Cl2NO4S and a molecular weight of 346.2 g/mol. IUPAC name: 4-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid. InChIKey: UMXULSULDRDBOZ-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO4S |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 4-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid |
| InChIKey | UMXULSULDRDBOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)