CAS 88522-30-9 appears in our catalog under these names: 3-(2,5-Dichloro-benzenesulfonylamino)-benzoic acid, 95%, 3-(2,5-Dichloro-benzenesulfonylamino)-benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-[(2,5-dichlorophenyl)sulfonylamino]benzoic acid (CAS 88522-30-9) is a chemical compound with the molecular formula C13H9Cl2NO4S and a molecular weight of 346.2 g/mol. IUPAC name: 3-[(2,5-dichlorophenyl)sulfonylamino]benzoic acid. InChIKey: CQEZSDZFELLDDA-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO4S |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 3-[(2,5-dichlorophenyl)sulfonylamino]benzoic acid |
| InChIKey | CQEZSDZFELLDDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=C(C=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)