Products 96460-18-3

CAS 96460-18-3 is the registry number for 2-(3,4-Dichloro-benzenesulfonylamino)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

2-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid (CAS 96460-18-3) is a chemical compound with the molecular formula C13H9Cl2NO4S and a molecular weight of 346.2 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid. InChIKey: YKJHDHHIYSFGGR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9Cl2NO4S
Molecular weight346.2 g/mol
IUPAC name2-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid
InChIKeyYKJHDHHIYSFGGR-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)