CAS 380432-28-0 appears in our catalog under these names: 3-(3,4-Dichlorobenzenesulfonamido)benzoic acid, 95%, 95%, 3-(3,4-Dichlorobenzenesulfonamido)benzoic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid (CAS 380432-28-0) is a chemical compound with the molecular formula C13H9Cl2NO4S and a molecular weight of 346.2 g/mol. IUPAC name: 3-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid. InChIKey: AKPAXFIVLVXWKY-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO4S |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 3-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid |
| InChIKey | AKPAXFIVLVXWKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)