Products 327092-79-5
CAS 327092-79-5 appears in our catalog under these names: 3-(2,5-Dichloro-phenylsulfamoyl)-benzoic acid, 95%, 3-((2,5-Dichlorophenyl)sulfamoyl)benzoic acid, 95%, 3-((2,5-Dichlorophenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-[(2,5-dichlorophenyl)sulfamoyl]benzoic acid (CAS 327092-79-5) is a chemical compound with the molecular formula C13H9Cl2NO4S and a molecular weight of 346.2 g/mol. IUPAC name: 3-[(2,5-dichlorophenyl)sulfamoyl]benzoic acid. InChIKey: FAZWJWDFXYVIJW-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO4S |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 3-[(2,5-dichlorophenyl)sulfamoyl]benzoic acid |
| InChIKey | FAZWJWDFXYVIJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=C(C=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)