CAS 312503-21-2 is the registry number for 2-Hydroxy-N-mesitylbenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-N-(2,4,6-trimethylphenyl)benzamide (CAS 312503-21-2) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: 2-hydroxy-N-(2,4,6-trimethylphenyl)benzamide. InChIKey: NGSKFFMLBJPJIR-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-hydroxy-N-(2,4,6-trimethylphenyl)benzamide |
| InChIKey | NGSKFFMLBJPJIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)C2=CC=CC=C2O)C |
Computed by PubChem (NCBI)