CAS 312584-53-5 appears in our catalog under these names: 4-Chloro-5-(4-methoxyphenyl)thieno[2,3-d]pyrimidine, 95%, 4–CHLORO–5–(4–METHOXYPHENYL)THIENO(2,3–D)PYRIMIDINE, 4-Chloro-5-(4-methoxy-phenyl)-thieno[2,3-d]-pyrimidine, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
4-chloro-5-(4-methoxyphenyl)thieno[2,3-d]pyrimidine (CAS 312584-53-5) is a chemical compound with the molecular formula C13H9ClN2OS and a molecular weight of 276.74 g/mol. IUPAC name: 4-chloro-5-(4-methoxyphenyl)thieno[2,3-d]pyrimidine. InChIKey: MZBKUNFWNKYKSK-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2OS |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | 4-chloro-5-(4-methoxyphenyl)thieno[2,3-d]pyrimidine |
| InChIKey | MZBKUNFWNKYKSK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CSC3=C2C(=NC=N3)Cl |
Computed by PubChem (NCBI)