CAS 89567-07-7 is the registry number for 2-(Chloromethyl)-5-phenylthieno(2,3-d)pyrimidin-4(3H)-one, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-(chloromethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 89567-07-7) is a chemical compound with the molecular formula C13H9ClN2OS and a molecular weight of 276.74 g/mol. IUPAC name: 2-(chloromethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: AXYRETOKOZYAQM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2OS |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | 2-(chloromethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | AXYRETOKOZYAQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2C(=O)NC(=N3)CCl |
Computed by PubChem (NCBI)